ethyl 3-(benzyl-(phenylthiocarbamoyl)amino)propanoate structure
|
Common Name | ethyl 3-(benzyl-(phenylthiocarbamoyl)amino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 86727-07-3 | Molecular Weight | 342.45500 | |
| Density | 1.204g/cm3 | Boiling Point | 472.8ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | ethyl 3-[benzyl(phenylcarbamothioyl)amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760 mmHg |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.45500 |
| Flash Point | 239.8ºC |
| Exact Mass | 342.14000 |
| PSA | 73.66000 |
| LogP | 3.91180 |
| Index of Refraction | 1.628 |
| InChIKey | ZVTHCWOEBMUPOP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)Nc1ccccc1 |
|
~89%
ethyl 3-(benzyl... CAS#:86727-07-3 |
| Literature: Okawara, Tadashi; Nakayama, Kentaro; Furukawa, Mitsuru Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 2 p. 507 - 512 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-benzyl-1-ethoxycarbonylethyl-3-phenylthiourea |