2,2'-Disulfanediylbis(6-methylaniline) structure
|
Common Name | 2,2'-Disulfanediylbis(6-methylaniline) | ||
|---|---|---|---|---|
| CAS Number | 86749-03-3 | Molecular Weight | 276.420 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 423.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8±28.7 °C | |
| Name | 2-[(2-amino-3-methylphenyl)disulfanyl]-6-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.2±45.0 °C at 760 mmHg |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.420 |
| Flash Point | 209.8±28.7 °C |
| Exact Mass | 276.075500 |
| PSA | 102.64000 |
| LogP | 3.97 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | NQJCQIDMAFODQD-UHFFFAOYSA-N |
| SMILES | Cc1cccc(SSc2cccc(C)c2N)c1N |
| HS Code | 2930909090 |
|---|
|
~%
2,2'-Disulfaned... CAS#:86749-03-3 |
| Literature: Campiani; Nacci; Fiorini; De Filippis, Mp; Garofalo; Ciani; Greco; Novellino; Manzoni; Mennini European Journal of Medicinal Chemistry, 1997 , vol. 32, # 3 p. 241 - 251 |
|
~%
2,2'-Disulfaned... CAS#:86749-03-3 |
| Literature: Hodgson; France Journal of the Chemical Society, 1933 , p. 296 |
|
~%
2,2'-Disulfaned... CAS#:86749-03-3 |
| Literature: Hodgson; France Journal of the Chemical Society, 1933 , p. 296 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6,6'-Dimethyl-2,2'-disulfandiyl-di-anilin |
| RW2833 |
| 2.2'-Diamino-3.3'-dimethyl-diphenyldisulfid |
| 2,2'-Disulfanediylbis(6-methylaniline) |
| Benzenamine, 2,2'-dithiobis[6-methyl- |
| 6,6'-dimethyl-2,2'-disulfanediyl-di-aniline |