propyl cyclopropylmethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyr idine-3,5-dicarboxylate structure
|
Common Name | propyl cyclopropylmethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyr idine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 86781-09-1 | Molecular Weight | 414.45200 | |
| Density | 1.238g/cm3 | Boiling Point | 542.9ºC at 760 mmHg | |
| Molecular Formula | C22H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 5-O-(cyclopropylmethyl) 3-O-propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 542.9ºC at 760 mmHg |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.45200 |
| Flash Point | 282.1ºC |
| Exact Mass | 414.17900 |
| PSA | 110.45000 |
| LogP | 4.58800 |
| Index of Refraction | 1.565 |
| InChIKey | RYNOIKBDZXRVBG-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC2CC2)C1c1cccc([N+](=O)[O-])c1 |
|
~61%
propyl cyclopro... CAS#:86781-09-1 |
| Literature: Ohno; Komatsu; Mizukoshi; Ichihara; Nakamura; Morishima; Sumita Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1589 - 1606 |
|
~%
propyl cyclopro... CAS#:86781-09-1 |
| Literature: Ohno; Komatsu; Mizukoshi; Ichihara; Nakamura; Morishima; Sumita Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1589 - 1606 |
|
~%
propyl cyclopro... CAS#:86781-09-1 |
| Literature: Ohno; Komatsu; Mizukoshi; Ichihara; Nakamura; Morishima; Sumita Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1589 - 1606 |
|
~%
propyl cyclopro... CAS#:86781-09-1 |
| Literature: Ohno; Komatsu; Mizukoshi; Ichihara; Nakamura; Morishima; Sumita Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1589 - 1606 |
| cyclopropylmethyl ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| cyclopropylmethyl 3-oxahexadecanoate |
| Acetic acid,(tridecyloxy)-,cyclopropylmethyl ester |
| cyclopropylmethyl propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |