Diethyl 2,6-dibromoheptanedioate structure
|
Common Name | Diethyl 2,6-dibromoheptanedioate | ||
|---|---|---|---|---|
| CAS Number | 868-68-8 | Molecular Weight | 374.066 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 357.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H18Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.0±27.9 °C | |
| Name | Diethyl 2,6-dibromoheptanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.4±42.0 °C at 760 mmHg |
| Molecular Formula | C11H18Br2O4 |
| Molecular Weight | 374.066 |
| Flash Point | 170.0±27.9 °C |
| Exact Mass | 371.957184 |
| PSA | 52.60000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | SPJSPERKKWTTBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)CCCC(Br)C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~85%
Diethyl 2,6-dib... CAS#:868-68-8 |
| Literature: NeuroSearch A/S Patent: WO2007/65892 A1, 2007 ; Location in patent: Page/Page column 20 ; |
|
~%
Diethyl 2,6-dib... CAS#:868-68-8 |
| Literature: Chemische Berichte, , vol. 28, p. 660 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Dibrom-heptandisaeure-diaethylester |
| Diethyl 2,6-dibromoheptanedioate |
| 2,6-dibromo-heptanedioic acid diethyl ester |
| EINECS 212-781-7 |
| diethyl meso-2,6-dibromopimeloate |
| Heptanedioic acid, 2,6-dibromo-, diethyl ester |