ethyl 2-[8-(4-chlorophenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]acetate structure
|
Common Name | ethyl 2-[8-(4-chlorophenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 86818-20-4 | Molecular Weight | 329.77800 | |
| Density | 1.26g/cm3 | Boiling Point | 456.7ºC at 760 mmHg | |
| Molecular Formula | C18H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | ethyl 2-[3-(4-chlorophenyl)-2H-1,4-benzoxazin-6-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760 mmHg |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.77800 |
| Flash Point | 230ºC |
| Exact Mass | 329.08200 |
| PSA | 47.89000 |
| LogP | 3.39440 |
| Index of Refraction | 1.599 |
| InChIKey | XHLZQCCCRXCUGZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc2c(c1)N=C(c1ccc(Cl)cc1)CO2 |
|
~49%
ethyl 2-[8-(4-c... CAS#:86818-20-4 |
| Literature: Shridhar, D. R.; Sastry, C. V. Reddy; Bansal, O. P.; Rao, P. Pulla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 3 p. 297 - 299 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-(4-Chlorophenyl)-2H-1,4-benzoxazine-6-acetic acid ethyl ester |
| Ethyl 3-p-chlorophenyl-2H-1,4-benzoxazine-6-acetate |
| 2H-1,4-Benzoxazine-6-acetic acid,3-(4-chlorophenyl)-,ethyl ester |