ethyl 2-[8-(4-methylphenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]acetate structure
|
Common Name | ethyl 2-[8-(4-methylphenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 86818-22-6 | Molecular Weight | 309.35900 | |
| Density | 1.16g/cm3 | Boiling Point | 445.6ºC at 760 mmHg | |
| Molecular Formula | C19H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | ethyl 2-[3-(4-methylphenyl)-2H-1,4-benzoxazin-6-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760 mmHg |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.35900 |
| Flash Point | 183.5ºC |
| Exact Mass | 309.13600 |
| PSA | 47.89000 |
| LogP | 3.04940 |
| Index of Refraction | 1.581 |
| InChIKey | ZKRHNAQFQZIGMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc2c(c1)N=C(c1ccc(C)cc1)CO2 |
|
~45%
ethyl 2-[8-(4-m... CAS#:86818-22-6 |
| Literature: Shridhar, D. R.; Sastry, C. V. Reddy; Bansal, O. P.; Rao, P. Pulla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 3 p. 297 - 299 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2H-1,4-Benzoxazine-6-acetic acid,3-(4-methylphenyl)-,ethyl ester |
| 3-(4-Methylphenyl)-2H-1,4-benzoxazine-6-acetic acid ethyl ester |