ethyl 2-[8-(4-chlorophenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]propanoate structure
|
Common Name | ethyl 2-[8-(4-chlorophenyl)-10-oxa-7-azabicyclo[4.4.0]deca-2,4,7,11-te traen-4-yl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 86818-23-7 | Molecular Weight | 343.80400 | |
| Density | 1.24g/cm3 | Boiling Point | 456.2ºC at 760 mmHg | |
| Molecular Formula | C19H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.7ºC | |
| Name | ethyl 2-[3-(4-chlorophenyl)-2H-1,4-benzoxazin-6-yl]propanoate |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760 mmHg |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.80400 |
| Flash Point | 229.7ºC |
| Exact Mass | 343.09800 |
| PSA | 47.89000 |
| LogP | 3.95540 |
| Index of Refraction | 1.593 |
| InChIKey | DCJFFSZTRFMEAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)c1ccc2c(c1)N=C(c1ccc(Cl)cc1)CO2 |
|
~48%
ethyl 2-[8-(4-c... CAS#:86818-23-7 |
| Literature: Shridhar, D. R.; Sastry, C. V. Reddy; Bansal, O. P.; Rao, P. Pulla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 3 p. 297 - 299 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |