N-(6-fluorobenzo[d]thiazol-2-yl)-4-(N-methyl-N-((tetrahydrofuran-2-yl)methyl)sulfamoyl)benzamide structure
|
Common Name | N-(6-fluorobenzo[d]thiazol-2-yl)-4-(N-methyl-N-((tetrahydrofuran-2-yl)methyl)sulfamoyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 868675-80-3 | Molecular Weight | 449.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20FN3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(6-fluorobenzo[d]thiazol-2-yl)-4-(N-methyl-N-((tetrahydrofuran-2-yl)methyl)sulfamoyl)benzamide |
|---|
| Molecular Formula | C20H20FN3O4S2 |
|---|---|
| Molecular Weight | 449.5 |
| InChIKey | XBBZNYMLEKZSJZ-UHFFFAOYSA-N |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccc(F)cc3s2)cc1 |
|
Name: High-throughput screen for inhibitors of the GIV GBA-motif interaction with Galpha-i ...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS1303
|