N-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]methanesulfonamide structure
|
Common Name | N-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 868692-55-1 | Molecular Weight | 399.55600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClF3INO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClF3INO2S |
|---|---|
| Molecular Weight | 399.55600 |
| Exact Mass | 398.88000 |
| PSA | 54.55000 |
| LogP | 4.48870 |
| InChIKey | KLXSBEABNFUDND-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1cc(C(F)(F)F)c(Cl)cc1I |
|
~%
N-[4-chloro-2-i... CAS#:868692-55-1 |
| Literature: Lanter, James C.; Fiordeliso, James J.; Allan, George F.; Musto, Amy; Hahn, Do Won; Sui, Zhihua Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 21 p. 5646 - 5649 |
|
~%
N-[4-chloro-2-i... CAS#:868692-55-1 |
| Literature: Lanter, James C.; Fiordeliso, James J.; Allan, George F.; Musto, Amy; Hahn, Do Won; Sui, Zhihua Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 21 p. 5646 - 5649 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanesulfonamide,N-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl] |
| N-(4-chloro-2-iodo-5-trifluoromethyl-phenyl)-methanesulfonamide |