6-methylsulfanyl-7,9-dihydropurine-8-thione structure
|
Common Name | 6-methylsulfanyl-7,9-dihydropurine-8-thione | ||
|---|---|---|---|---|
| CAS Number | 86870-58-8 | Molecular Weight | 198.26900 | |
| Density | 1.6g/cm3 | Boiling Point | 366.3ºC at 760 mmHg | |
| Molecular Formula | C6H6N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 6-methylsulfanyl-7,9-dihydropurine-8-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 366.3ºC at 760 mmHg |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.26900 |
| Flash Point | 175.3ºC |
| Exact Mass | 198.00300 |
| PSA | 114.75000 |
| LogP | 1.73740 |
| Index of Refraction | 1.779 |
| InChIKey | FWJCRGOKPKPLBW-UHFFFAOYSA-N |
| SMILES | CSc1ncnc2[nH]c(=S)[nH]c12 |
|
~%
6-methylsulfany... CAS#:86870-58-8 |
| Literature: Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 6671,6675 |
|
~%
6-methylsulfany... CAS#:86870-58-8 |
| Literature: Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 6671,6675 |
| 6-methylsulfanyl-7,9-dihydro-purine-8-thione |
| 6-Methylmercapto-7,9-dihydro-purin-8-thion |