tert-butyl-[1-(cyclopenten-1-yl)ethenoxy]-dimethylsilane structure
|
Common Name | tert-butyl-[1-(cyclopenten-1-yl)ethenoxy]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 86891-78-3 | Molecular Weight | 224.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-[1-(cyclopenten-1-yl)ethenoxy]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H24OSi |
|---|---|
| Molecular Weight | 224.41500 |
| Exact Mass | 224.16000 |
| PSA | 9.23000 |
| LogP | 4.63220 |
| InChIKey | HARIOQJHHQIUQP-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C1=CCCC1 |
|
~97%
tert-butyl-[1-(... CAS#:86891-78-3 |
| Literature: Orban, John; Turner, John V.; Twitchin, Bruce Tetrahedron Letters, 1984 , vol. 25, # 44 p. 5099 - 5102 |
|
~%
tert-butyl-[1-(... CAS#:86891-78-3 |
| Literature: Liu, Chunjian; Bao, Guanglin; Burnell, D. Jean Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 20 p. 2644 - 2656 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(1-cyclopentenyl)-1-[(tert-butyldimethylsilyl)oxy]ethene |
| 1-{[(1,1-dimethylethyl)dimethylsilyloxy]ethenyl}cyclopentene |
| Silane,[[1-(1-cyclopenten-1-yl)ethenyl]oxy](1,1-dimethylethyl)dimethyl |