4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride structure
|
Common Name | 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 869002-97-1 | Molecular Weight | 209.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H12ClN3OS |
|---|---|
| Molecular Weight | 209.70 |
| InChIKey | PQOSROXADSFTRB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(SC(=N)N)=NO1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: Molecular weight of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is 209.70. |
| Q: What is the molecular formula of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: Molecular formula of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is C6H12ClN3OS. |
| Q: What is the CAS number of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: CAS number of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is 869002-97-1. |
| Q: What is the English name of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: The English name of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride. |
| Q: What is the SMILES notation of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: SMILES notation of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is CC1(C)CC(SC(=N)N)=NO1.Cl. |
| Q: What is the Chinese name of 869002-97-1? |
| A: Chinese name of 869002-97-1 is 869002-97-1. |
| Q: What is the InChIKey of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride? |
| A: InChIKey of 4,5-Dihydro-5,5-dimethyl-3-isoxazolyl carbamimidothioate hydrochloride is PQOSROXADSFTRB-UHFFFAOYSA-N. |