3-(3,4-dimethoxyphenyl)-2-oxo-2H-chromen-7-yl 1,3-benzodioxole-5-carboxylate
Modify Date: 2025-09-13 19:25:07
3-(3,4-dimethoxyphenyl)-2-oxo-2H-chromen-7-yl 1,3-benzodioxole-5-carboxylate structure
|
Common Name | 3-(3,4-dimethoxyphenyl)-2-oxo-2H-chromen-7-yl 1,3-benzodioxole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 869080-71-7 | Molecular Weight | 446.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3,4-dimethoxyphenyl)-2-oxo-2H-chromen-7-yl 1,3-benzodioxole-5-carboxylate |
|---|
| Molecular Formula | C25H18O8 |
|---|---|
| Molecular Weight | 446.4 |
| InChIKey | ZECHLNFSGMXAAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc3ccc(OC(=O)c4ccc5c(c4)OCO5)cc3oc2=O)cc1OC |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1