ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate
Modify Date: 2026-07-08 07:37:24
![ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate Structure](https://www.chemsrc.com/extcaspic/426/869080-90-0.png)
ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate structure
|
Common Name | ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate | ||
|---|---|---|---|---|
| CAS Number | 869080-90-0 | Molecular Weight | 372.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17ClO5 |
|---|---|
| Molecular Weight | 372.8 |
| InChIKey | DSOHJAJZRPVFOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: SMILES notation of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is CCOC(=O)C(C)Oc1ccc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1. |
| Q: What is the Chinese name of 869080-90-0? |
| A: Chinese name of 869080-90-0 is 869080-90-0. |
| Q: What is the English name of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: The English name of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate. |
| Q: What is the molecular formula of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: Molecular formula of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is C20H17ClO5. |
| Q: What is the InChIKey of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: InChIKey of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is DSOHJAJZRPVFOK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: Molecular weight of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is 372.8. |
| Q: What is the CAS number of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate? |
| A: CAS number of ethyl 2-{[3-(4-chlorophenyl)-2-oxo-2H-chromen-7-yl]oxy}propanoate is 869080-90-0. |