Phosphonous diamide,P,P'-1,4-butanediylbis[N,N,N',N'-tetraethyl- (9CI) structure
|
Common Name | Phosphonous diamide,P,P'-1,4-butanediylbis[N,N,N',N'-tetraethyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 86926-30-9 | Molecular Weight | 406.56900 | |
| Density | N/A | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C20H48N4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | N-[4-[bis(diethylamino)phosphanyl]butyl-(diethylamino)phosphanyl]-N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 462.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H48N4P2 |
| Molecular Weight | 406.56900 |
| Flash Point | 233.3ºC |
| Exact Mass | 406.33500 |
| PSA | 40.14000 |
| LogP | 5.75760 |
| InChIKey | QXJKGYSGLGSPPG-UHFFFAOYSA-N |
| SMILES | CCN(CC)P(CCCCP(N(CC)CC)N(CC)CC)N(CC)CC |
|
~70%
Phosphonous dia... CAS#:86926-30-9 |
| Literature: Diemert, Klaus; Kuchen, Wilhelm; Kutter, Juergen Phosphorus and Sulfur and the Related Elements, 1983 , vol. 15, p. 155 - 164 |
|
~%
Phosphonous dia... CAS#:86926-30-9 |
| Literature: Diemert, Klaus; Kuchen, Wilhelm; Kutter, Juergen Chemische Berichte, 1982 , vol. 115, # 5 p. 1947 - 1955 |
| 1,4-butandiylbis{bis(diethylamino)phosphane} |
| 1,4-bis-(bis-(diethylamino)phosphino)butane |
| 1,4-Butandiylbis(bis(diethylamino)phosphan) |