1-Boc-2,2-Dimethylpyrrolidine structure
|
Common Name | 1-Boc-2,2-Dimethylpyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 869527-80-0 | Molecular Weight | 199.290 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 241.9±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.1±18.7 °C | |
| Name | tert-Butyl 2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 241.9±9.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.290 |
| Flash Point | 100.1±18.7 °C |
| Exact Mass | 199.157227 |
| PSA | 29.54000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | BQWREAOXJRHDQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Pyrrolidinecarboxylic acid, 2,2-dimethyl-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 2,2-dimethyl-1-pyrrolidinecarboxylate |
| tert-butyl 2,2-dimethylpyrrolidine-1-carboxylate |