1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde
Modify Date: 2025-09-11 22:25:56
![1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde Structure](https://www.chemsrc.com/extcaspic/057/869558-93-0.png)
1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde structure
|
Common Name | 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 869558-93-0 | Molecular Weight | 226.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N2O2Si |
|---|---|
| Molecular Weight | 226.35 |
| InChIKey | SSOMUWSBEIEHHE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCn1ccc(C=O)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 869558-93-0? |
| A: Chinese name of 869558-93-0 is 869558-93-0. |
| Q: What is the English name of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: The English name of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde. |
| Q: What is the molecular weight of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: Molecular weight of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is 226.35. |
| Q: What is the SMILES notation of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: SMILES notation of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is C[Si](C)(C)CCOCn1ccc(C=O)n1. |
| Q: What is the CAS number of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: CAS number of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is 869558-93-0. |
| Q: What is the molecular formula of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: Molecular formula of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is C10H18N2O2Si. |
| Q: What is the InChIKey of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde? |
| A: InChIKey of 1-{[2-(trimethylsilyl)ethoxy]methyl}-1H-pyrazole-3-carbaldehyde is SSOMUWSBEIEHHE-UHFFFAOYSA-N. |