1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate
Modify Date: 2025-09-09 15:44:53
1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate structure
|
Common Name | 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 869564-38-5 | Molecular Weight | 258.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N2O4 |
|---|---|
| Molecular Weight | 258.31 |
| InChIKey | VSYXYJDOKAFLDT-IUCAKERBSA-N |
| SMILES | COC(=O)C1CCC(N)CN1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 869564-38-5? |
| A: Chinese name of 869564-38-5 is 869564-38-5. |
| Q: What is the SMILES notation of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: SMILES notation of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is COC(=O)C1CCC(N)CN1C(=O)OC(C)(C)C. |
| Q: What is the molecular weight of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: Molecular weight of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is 258.31. |
| Q: What is the CAS number of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: CAS number of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is 869564-38-5. |
| Q: What is the English name of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: The English name of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate. |
| Q: What is the InChIKey of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: InChIKey of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is VSYXYJDOKAFLDT-IUCAKERBSA-N. |
| Q: What is the molecular formula of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate? |
| A: Molecular formula of 1-(tert-Butyl) 2-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate is C12H22N2O4. |