4-ethyl-3-nitroso-2-phenylpyrazolo[1,5-a]pyrimidin-7-one structure
|
Common Name | 4-ethyl-3-nitroso-2-phenylpyrazolo[1,5-a]pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 86969-30-4 | Molecular Weight | 268.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-3-nitroso-2-phenylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N4O2 |
|---|---|
| Molecular Weight | 268.27100 |
| Exact Mass | 268.09600 |
| PSA | 68.73000 |
| LogP | 2.58080 |
| InChIKey | SRFJBHAWFLWXSL-UHFFFAOYSA-N |
| SMILES | CCn1ccc(=O)n2nc(-c3ccccc3)c(N=O)c12 |
|
~15%
4-ethyl-3-nitro... CAS#:86969-30-4 |
| Literature: Journal of Medicinal Chemistry, 1983 , vol. 26, # 12 p. 1706 - 1709 |
|
~%
4-ethyl-3-nitro... CAS#:86969-30-4 |
| Literature: Journal of Medicinal Chemistry, 1983 , vol. 26, # 12 p. 1706 - 1709 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Pyrazolo[1,5-a]pyrimidin-7(4H)-one,4-ethyl-3-nitroso-2-phenyl |