Carbamic acid, (5-amino-3-phenyl-2H-pyrido[4,3-b]-1, 4-thiazin-7-yl)-, ethyl ester structure
|
Common Name | Carbamic acid, (5-amino-3-phenyl-2H-pyrido[4,3-b]-1, 4-thiazin-7-yl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 86970-55-0 | Molecular Weight | 328.38900 | |
| Density | 1.4g/cm3 | Boiling Point | 487.6ºC at 760 mmHg | |
| Molecular Formula | C16H16N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | ethyl N-(5-amino-3-phenyl-2H-pyrido[4,3-b][1,4]thiazin-7-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 487.6ºC at 760 mmHg |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.38900 |
| Flash Point | 248.7ºC |
| Exact Mass | 328.09900 |
| PSA | 114.90000 |
| LogP | 3.54850 |
| Index of Refraction | 1.695 |
| InChIKey | GQRKAIRIFLZLLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc2c(c(N)n1)N=C(c1ccccc1)CS2 |
|
~41%
Carbamic acid, ... CAS#:86970-55-0 |
| Literature: Journal of Medicinal Chemistry, 1983 , vol. 26, # 11 p. 1614 - 1619 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Carbamic acid,[5-amino-3-phenyl-2H-pyrido[4,3-b][1,4]-thiazin-7-yl]-,ethyl ester |
| ethyl (5-amino-3-phenyl-2H-pyrido[4,3-b][1,4]thiazin-7-yl)carbamate |
| Carbamic acid,3-b]-1,4-thiazin-7-yl)-,ethyl ester |