[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate
Modify Date: 2026-07-12 23:10:23
![[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate Structure](https://www.chemsrc.com/extcaspic/401/869711-50-2.png)
[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate structure
|
Common Name | [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate | ||
|---|---|---|---|---|
| CAS Number | 869711-50-2 | Molecular Weight | 331.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21N3O4 |
|---|---|
| Molecular Weight | 331.4 |
| InChIKey | FWWCFRKLVWPUJJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NC(C)(C#N)C(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: CAS number of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is 869711-50-2. |
| Q: What is the molecular weight of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: Molecular weight of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is 331.4. |
| Q: What is the InChIKey of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: InChIKey of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is FWWCFRKLVWPUJJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: SMILES notation of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is CC(=O)Nc1ccc(C(=O)OCC(=O)NC(C)(C#N)C(C)C)cc1. |
| Q: What is the Chinese name of 869711-50-2? |
| A: Chinese name of 869711-50-2 is 869711-50-2. |
| Q: What is the molecular formula of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: Molecular formula of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is C17H21N3O4. |
| Q: What is the English name of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate? |
| A: The English name of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate is [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 4-acetamidobenzoate. |