4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline
Modify Date: 2026-07-27 18:56:12
4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline structure
|
Common Name | 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 869737-50-8 | Molecular Weight | 276.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H28N2O |
|---|---|
| Molecular Weight | 276.4 |
| InChIKey | CWLGAYSZCJYGNH-UHFFFAOYSA-N |
| SMILES | CC(ON1C(C)(C)CCCC1(C)C)c1ccc(N)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: The English name of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline. |
| Q: What is the molecular formula of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: Molecular formula of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is C17H28N2O. |
| Q: What is the molecular weight of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: Molecular weight of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is 276.4. |
| Q: What is the Chinese name of 869737-50-8? |
| A: Chinese name of 869737-50-8 is 869737-50-8. |
| Q: What is the InChIKey of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: InChIKey of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is CWLGAYSZCJYGNH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: CAS number of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is 869737-50-8. |
| Q: What is the SMILES notation of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline? |
| A: SMILES notation of 4-(1-((2,2,6,6-Tetramethylpiperidin-1-yl)oxy)ethyl)aniline is CC(ON1C(C)(C)CCCC1(C)C)c1ccc(N)cc1. |