1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate
Modify Date: 2026-08-22 11:46:34
![1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate Structure](https://www.chemsrc.com/extcaspic/183/869872-33-3.png)
1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate structure
|
Common Name | 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate | ||
|---|---|---|---|---|
| CAS Number | 869872-33-3 | Molecular Weight | 456.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19F3N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H19F3N2O5S |
|---|---|
| Molecular Weight | 456.4 |
| InChIKey | BVARQKCFVLRMFO-VAWYXSNFSA-N |
| SMILES | CC(OC(=O)CNS(=O)(=O)C=Cc1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: SMILES notation of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is CC(OC(=O)CNS(=O)(=O)C=Cc1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1. |
| Q: What is the molecular formula of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: Molecular formula of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is C20H19F3N2O5S. |
| Q: What is the molecular weight of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: Molecular weight of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is 456.4. |
| Q: What is the InChIKey of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: InChIKey of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is BVARQKCFVLRMFO-VAWYXSNFSA-N. |
| Q: What is the English name of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: The English name of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate. |
| Q: What is the Chinese name of 869872-33-3? |
| A: Chinese name of 869872-33-3 is 869872-33-3. |
| Q: What is the CAS number of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate? |
| A: CAS number of 1-{[4-(Trifluoromethyl)phenyl]carbamoyl}ethyl 2-(2-phenylethenesulfonamido)acetate is 869872-33-3. |