(S)-1,2,3,4-tetrahydro-1-phenylisoquinoline D-(-)-tartrate structure
|
Common Name | (S)-1,2,3,4-tetrahydro-1-phenylisoquinoline D-(-)-tartrate | ||
|---|---|---|---|---|
| CAS Number | 869884-00-4 | Molecular Weight | 359.373 | |
| Density | N/A | Boiling Point | 338.4ºC at 760 mmHg | |
| Molecular Formula | C19H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.9ºC | |
| Name | (2S,3S)-2,3-dihydroxybutanedioic acid,(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 338.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.373 |
| Flash Point | 166.9ºC |
| Exact Mass | 359.136902 |
| PSA | 127.09000 |
| LogP | 1.12790 |
| InChIKey | SZEOPQAHUUEDMC-XQIJAYBJSA-N |
| SMILES | O=C(O)C(O)C(O)C(=O)O.c1ccc(C2NCCc3ccccc32)cc1 |
|
~90%
(S)-1,2,3,4-tet... CAS#:869884-00-4 |
| Literature: Perlman, Nurit; Nidam, Tamar Patent: US2008/91023 A1, 2008 ; Location in patent: Page/Page column 5 ; |
|
~86%
(S)-1,2,3,4-tet... CAS#:869884-00-4 |
| Literature: Perlman, Nurit; Nidam, Tamar Patent: US2008/91023 A1, 2008 ; Location in patent: Page/Page column 5 ; |
|
~%
(S)-1,2,3,4-tet... CAS#:869884-00-4 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 29 p. 10863 - 10869 |
| (2S,3S)-2,3-Dihydroxysuccinic acid - (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (1:1) |
| Butanedioic acid, 2,3-dihydroxy-, (2S,3S)-, compd. with (1S)-1,2,3,4-tetrahydro-1-phenylisoquinoline (1:1) |
| ac-4738 |