(4-Cyclopropyl-6-trifluoromethyl-pyrimidin-2-yl)-hydrazine structure
|
Common Name | (4-Cyclopropyl-6-trifluoromethyl-pyrimidin-2-yl)-hydrazine | ||
|---|---|---|---|---|
| CAS Number | 869945-40-4 | Molecular Weight | 218.17900 | |
| Density | 1.515g/cm3 | Boiling Point | 325.5ºC at 760 mmHg | |
| Molecular Formula | C8H9F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | [4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 325.5ºC at 760 mmHg |
| Molecular Formula | C8H9F3N4 |
| Molecular Weight | 218.17900 |
| Flash Point | 150.7ºC |
| Exact Mass | 218.07800 |
| PSA | 67.06000 |
| LogP | 1.78060 |
| Index of Refraction | 1.58 |
| InChIKey | SXLHMFGZWJPBDF-UHFFFAOYSA-N |
| SMILES | NNc1nc(C2CC2)cc(C(F)(F)F)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Cyclopropyl-2-hydrazinyl-6-(trifluoromethyl)pyrimidine |
| (4-Cyclopropyl-6-trifluoromethyl-pyrimidin-2-yl)-hydrazine |