D-glycero-D-gulo-heptonic acid
D-glycero-D-gulo-heptonic acid structure
|
Common Name | D-glycero-D-gulo-heptonic acid | ||
|---|---|---|---|---|
| CAS Number | 87-74-1 | Molecular Weight | 226.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | glucoheptonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H14O8 |
|---|---|
| Molecular Weight | 226.18100 |
| Exact Mass | 226.06900 |
| PSA | 158.68000 |
| InChIKey | KWMLJOLKUYYJFJ-VFUOTHLCSA-N |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)C(O)CO |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:89-67-8
CAS#:111-14-8
CAS#:3146-50-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| D-GLYCERO-D-GULO-HEPTONIC ACID |
| heptagluconic acid |
| D-glycero-D-gulo-Heptonsaeure |
| D-glycero-D-gulo-heptonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of glucoheptonic acid? |
| A: Molecular weight of glucoheptonic acid is 226.18100. |
| Q: What is the InChIKey of glucoheptonic acid? |
| A: InChIKey of glucoheptonic acid is KWMLJOLKUYYJFJ-VFUOTHLCSA-N. |
| Q: What is the SMILES notation of glucoheptonic acid? |
| A: SMILES notation of glucoheptonic acid is O=C(O)C(O)C(O)C(O)C(O)C(O)CO. |
| Q: What are the downstream products of glucoheptonic acid? |
| A: Related downstream products(CAS) of glucoheptonic acid: 89-67-8;111-14-8;3146-50-7. |
| Q: What is the polar surface area (PSA) of glucoheptonic acid? |
| A: Polar surface area (PSA) of glucoheptonic acid is 158.68000. |
| Q: What is the English name of glucoheptonic acid? |
| A: The English name of glucoheptonic acid is glucoheptonic acid. |
| Q: What is the CAS number of glucoheptonic acid? |
| A: CAS number of glucoheptonic acid is 87-74-1. |
| Q: What English synonyms does glucoheptonic acid have? |
| A: English synonyms of glucoheptonic acid: D-GLYCERO-D-GULO-HEPTONIC ACID, heptagluconic acid, D-glycero-D-gulo-Heptonsaeure, D-glycero-D-gulo-heptonic acid. |
| Q: What is the Chinese name of 87-74-1? |
| A: Chinese name of 87-74-1 is 87-74-1. |
| Q: What is the molecular formula of glucoheptonic acid? |
| A: Molecular formula of glucoheptonic acid is C7H14O8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |