Salbutamol EP impurity A structure
|
Common Name | Salbutamol EP impurity A | ||
|---|---|---|---|---|
| CAS Number | 870076-72-5 | Molecular Weight | 253.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Salbutamol EP impurity AAlbuterol methyl ether is a process impurity product associated with salbutamol that may be detected in urine samples. |
| Name | 4-[2-(tert-butylamino)-1-methoxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23NO3 |
|---|---|
| Molecular Weight | 253.33700 |
| Exact Mass | 253.16800 |
| PSA | 61.72000 |
| LogP | 2.35100 |
| InChIKey | UMHASVFLCHGDPW-UHFFFAOYSA-N |
| SMILES | COC(CNC(C)(C)C)c1ccc(O)c(CO)c1 |
|
~0%
Salbutamol EP i... CAS#:870076-72-5
Detail
Learn More
|
| Literature: Merli, Valeriano; Mantovani, Silvia; Bianchi, Stefano; Daverio, Paola Patent: US2005/261368 A1, 2005 ; Location in patent: Page/Page column 8-10 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(2-(tert-Butylamino)-1-methoxyethyl)-2-(hydroxymethyl)phenol |
| Levalbuterol related compound H |
| UNII-UJ45GD7950 |
| Albuterol Methyl Ether |
| N-(tert-butyl)-2-methoxy-2-(4-hydroxy-3-(hydroxymethyl)phen-1-yl)-ethanamine |
| Levalbuterol related compound H [USP] |
| SLB-OMe sec |
| Salbutamol EP impurity A |