2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione
2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione structure
|
Common Name | 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 870171-40-7 | Molecular Weight | 269.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12FNO2 |
|---|---|
| Molecular Weight | 269.27000 |
| Exact Mass | 269.08500 |
| PSA | 37.38000 |
| LogP | 3.30810 |
| InChIKey | XKJPQFREHPUKSB-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)C(=O)N(c1cccc(F)c1)C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(3-fluorophen... CAS#:870171-40-7 |
| Literature: Maruishi Pharmaceutical Co., Ltd. Patent: EP1749817 A1, 2007 ; Location in patent: Page/Page column 13 ; |
|
~74%
2-(3-fluorophen... CAS#:870171-40-7 |
| Literature: Kanamitsu, Norimasa; Osaki, Takashi; Itsuji, Yutaka; Yoshimura, Masakazu; Tsujimoto, Hisashi; Soga, Manabu Chemical and Pharmaceutical Bulletin, 2007 , vol. 55, # 12 p. 1682 - 1688 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(3-fluorophenyl)-5,6-dimethyl-1H-isoindol-1,3(2H)-dione |
| 2-(3-fluorophenyl)-5,6-dimethyl-1H-isoindole-1,3(2H)-dione |
| 1H-Isoindole-1,3(2H)-dione,2-(3-fluorophenyl)-5,6-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: Molecular weight of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is 269.27000. |
| Q: What English synonyms does 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione have? |
| A: English synonyms of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione: 2-(3-fluorophenyl)-5,6-dimethyl-1H-isoindol-1,3(2H)-dione, 2-(3-fluorophenyl)-5,6-dimethyl-1H-isoindole-1,3(2H)-dione, 1H-Isoindole-1,3(2H)-dione,2-(3-fluorophenyl)-5,6-dimethyl. |
| Q: What is the English name of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: The English name of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione. |
| Q: What is the LogP of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: LogP of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is 3.30810. |
| Q: What is the molecular formula of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: Molecular formula of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is C16H12FNO2. |
| Q: What is the polar surface area (PSA) of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: Polar surface area (PSA) of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is 37.38000. |
| Q: What is the InChIKey of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: InChIKey of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is XKJPQFREHPUKSB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: SMILES notation of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione is Cc1cc2c(cc1C)C(=O)N(c1cccc(F)c1)C2=O. |
| Q: What are the upstream materials of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione? |
| A: Related upstream materials(CAS) of 2-(3-fluorophenyl)-5,6-dimethylisoindole-1,3-dione: 372-19-0;5438-24-4;5999-20-2. |
| Q: What is the Chinese name of 870171-40-7? |
| A: Chinese name of 870171-40-7 is 870171-40-7. |