Letaxaban
Modify Date: 2025-08-25 10:17:30
Letaxaban structure
|
Common Name | Letaxaban | ||
|---|---|---|---|---|
| CAS Number | 870262-90-1 | Molecular Weight | 479.97700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26ClN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LetaxabanLetaxaban (TAK-442, TAK442) is a potent, selective and direct factor Xa (FXa) inhibitor with Ki of 1.8 nM for hFXa, >440-fold selectivity than thrombin and negligible effects on trypsin, plasmin, and tPA. |
| Name | 1-[1-[(2S)-3-(6-chloronaphthalen-2-yl)sulfonyl-2-hydroxypropanoyl]piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H26ClN3O5S |
|---|---|
| Molecular Weight | 479.97700 |
| Exact Mass | 479.12800 |
| PSA | 118.89000 |
| LogP | 2.63070 |
| InChIKey | GEHAEMCVKDPMKO-HXUWFJFHSA-N |
| SMILES | O=C(C(O)CS(=O)(=O)c1ccc2cc(Cl)ccc2c1)N1CCC(N2CCCNC2=O)CC1 |
| 3kl6 |
| Letaxaban |
| TAK-442 |