1-(5-Chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(5-Chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 870614-04-3 | Molecular Weight | 224.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-Chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
|---|
| Molecular Formula | C8H4ClF3O2 |
|---|---|
| Molecular Weight | 224.56400 |
| Exact Mass | 223.98500 |
| PSA | 37.30000 |
| LogP | 2.79060 |
| InChIKey | ZIEZOWUWNOVSDH-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Cl)ccc1O)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |