4,5-dichloro-2,2,4,5-tetrafluoro-1,3-dioxolane structure
|
Common Name | 4,5-dichloro-2,2,4,5-tetrafluoro-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 87075-00-1 | Molecular Weight | 214.93100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3Cl2F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dichloro-2,2,4,5-tetrafluoro-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3Cl2F4O2 |
|---|---|
| Molecular Weight | 214.93100 |
| Exact Mass | 213.92100 |
| PSA | 18.46000 |
| LogP | 2.30770 |
| InChIKey | QIMFRZPDPFVAOT-UHFFFAOYSA-N |
| SMILES | FC1(F)OC(F)(Cl)C(F)(Cl)O1 |
|
~92%
4,5-dichloro-2,... CAS#:87075-00-1 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4485250 A1, 1984 ; |
|
~0%
Detail
|
| Literature: Navarrini, Walter; Corti, Sandra Journal of Fluorine Chemistry, 2004 , vol. 125, # 2 p. 189 - 197 |
| 1,3-Dioxolane,4,5-dichloro-2,2,4,5-tetrafluoro |
| 4,5-dichloro-tetrafluoro-1,3-dioxolane |
| 4,5-dichloroperfluoro-1,3-diossolano |