1-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylprop-2-en-1-one structure
|
Common Name | 1-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 870770-71-1 | Molecular Weight | 318.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18O3 |
|---|---|
| Molecular Weight | 318.36600 |
| Exact Mass | 318.12600 |
| PSA | 35.53000 |
| LogP | 4.75310 |
| InChIKey | VOCWKGFFNOMSGD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc3ccccc3c2)cc1OC |
|
~%
1-(3,4-dimethox... CAS#:870770-71-1 |
| Literature: Pedrini, Fernanda Spezia; Chiaradia, Louise Domeneghini; Licinio, Marley Aparecida; De Moraes, Ana Carolina Rabello; Curta, Juliana Costa; Costa, Aline; Mascarello, Alessandra; Creczinsky-Pasa, Tania Beatriz; Nunes, Ricardo Jose; Yunes, Rosendo Augusto; Santos-Silva, Maria Claudia Journal of Pharmacy and Pharmacology, 2010 , vol. 62, # 9 p. 1128 - 1136 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Propen-1-one,1-(3,4-dimethoxyphenyl)-3-(2-naphthalenyl) |