Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl
![Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl Structure](https://image.chemsrc.com/caspic/488/87100-91-2.png)
Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl structure
|
Common Name | Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl | ||
|---|---|---|---|---|
| CAS Number | 87100-91-2 | Molecular Weight | 268.26700 | |
| Density | 1.31g/cm3 | Boiling Point | 459.1ºC at 760mmHg | |
| Molecular Formula | C15H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760mmHg |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.26700 |
| Flash Point | 231.5ºC |
| Exact Mass | 268.08500 |
| PSA | 65.10000 |
| LogP | 2.48970 |
| Index of Refraction | 1.645 |
| InChIKey | FIUSNLFQONUJCM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1coc2c(c(C)nn2-c2ccccc2)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~84%
Pyrano[2,3-c]py... CAS#:87100-91-2 |
| Literature: Gelin, Suzanne; Chantegrel, Bernard; Nadi, Abdel Ilah Journal of Organic Chemistry, 1983 , vol. 48, # 22 p. 4078 - 4082 |
|
~%
Pyrano[2,3-c]py... CAS#:87100-91-2 |
| Literature: Gelin, Suzanne; Chantegrel, Bernard; Nadi, Abdel Ilah Journal of Organic Chemistry, 1983 , vol. 48, # 22 p. 4078 - 4082 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 87100-91-2? |
| A: Chinese name of 87100-91-2 is 87100-91-2. |
| Q: What is the molecular formula of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: Molecular formula of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is C15H12N2O3. |
| Q: What is the molecular weight of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: Molecular weight of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 268.26700. |
| Q: What is the polar surface area (PSA) of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: Polar surface area (PSA) of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 65.10000. |
| Q: What is the LogP of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: LogP of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 2.48970. |
| Q: What is the CAS number of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: CAS number of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 87100-91-2. |
| Q: What is the boiling point of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: Boiling point of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 459.1ºC at 760mmHg. |
| Q: What are the upstream materials of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: Related upstream materials(CAS) of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one: 14036-06-7;87100-61-6;54107-17-4. |
| Q: What is the SMILES notation of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: SMILES notation of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is CC(=O)c1coc2c(c(C)nn2-c2ccccc2)c1=O. |
| Q: What is the English name of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one? |
| A: The English name of 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one is 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |