Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl structure
|
Common Name | Pyrano[2,3-c]pyrazol-4(1H)-one,5-acetyl-3-methyl-1-phenyl | ||
|---|---|---|---|---|
| CAS Number | 87100-91-2 | Molecular Weight | 268.26700 | |
| Density | 1.31g/cm3 | Boiling Point | 459.1ºC at 760mmHg | |
| Molecular Formula | C15H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | 5-acetyl-3-methyl-1-phenylpyrano[2,3-c]pyrazol-4-one |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760mmHg |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.26700 |
| Flash Point | 231.5ºC |
| Exact Mass | 268.08500 |
| PSA | 65.10000 |
| LogP | 2.48970 |
| Index of Refraction | 1.645 |
| InChIKey | FIUSNLFQONUJCM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1coc2c(c(C)nn2-c2ccccc2)c1=O |
|
~84%
Pyrano[2,3-c]py... CAS#:87100-91-2 |
| Literature: Gelin, Suzanne; Chantegrel, Bernard; Nadi, Abdel Ilah Journal of Organic Chemistry, 1983 , vol. 48, # 22 p. 4078 - 4082 |
|
~%
Pyrano[2,3-c]py... CAS#:87100-91-2 |
| Literature: Gelin, Suzanne; Chantegrel, Bernard; Nadi, Abdel Ilah Journal of Organic Chemistry, 1983 , vol. 48, # 22 p. 4078 - 4082 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |