(3-Bromo-5-isopropoxyphenyl)boronic acid structure
|
Common Name | (3-Bromo-5-isopropoxyphenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 871125-81-4 | Molecular Weight | 258.90500 | |
| Density | 1.47g/cm3 | Boiling Point | 377.9ºC at 760 mmHg | |
| Molecular Formula | C9H12BBrO3 | Melting Point | 140-145ºC | |
| MSDS | Chinese USA | Flash Point | 182.3ºC | |
| Name | 3-Bromo-5-isopropoxyphenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760 mmHg |
| Melting Point | 140-145ºC |
| Molecular Formula | C9H12BBrO3 |
| Molecular Weight | 258.90500 |
| Flash Point | 182.3ºC |
| Exact Mass | 258.00600 |
| PSA | 49.69000 |
| LogP | 0.91610 |
| Index of Refraction | 1.556 |
| InChIKey | OYCQIPZXNTZLQQ-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cc(Br)cc(B(O)O)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (3-bromo-5-propan-2-yloxyphenyl)boronic acid |