7-oxo-7-(3-phenoxyphenyl)heptanoic acid
Modify Date: 2025-09-12 16:11:39
7-oxo-7-(3-phenoxyphenyl)heptanoic acid structure
|
Common Name | 7-oxo-7-(3-phenoxyphenyl)heptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 871127-76-3 | Molecular Weight | 312.36000 | |
| Density | 1.162g/cm3 | Boiling Point | 506.23ºC at 760 mmHg | |
| Molecular Formula | C19H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.529ºC | |
| Name | 7-oxo-7-(3-phenoxyphenyl)heptanoic acid |
|---|
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 506.23ºC at 760 mmHg |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36000 |
| Flash Point | 181.529ºC |
| Exact Mass | 312.13600 |
| PSA | 63.60000 |
| LogP | 4.69670 |
| Index of Refraction | 1.564 |
| InChIKey | SYFGSXSIMQIKII-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCC(=O)c1cccc(Oc2ccccc2)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |