3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone
Modify Date: 2026-06-30 23:18:11
3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone structure
|
Common Name | 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone | ||
|---|---|---|---|---|
| CAS Number | 87116-18-5 | Molecular Weight | 256.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12O4 |
|---|---|
| Molecular Weight | 256.25 |
| InChIKey | VLFVSMPTIWLUJI-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC2OC(=O)c3ccccc32)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: InChIKey of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is VLFVSMPTIWLUJI-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: The English name of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone. |
| Q: What is the SMILES notation of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: SMILES notation of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is COc1ccc(OC2OC(=O)c3ccccc32)cc1. |
| Q: What is the Chinese name of 87116-18-5? |
| A: Chinese name of 87116-18-5 is 87116-18-5. |
| Q: What is the molecular formula of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: Molecular formula of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is C15H12O4. |
| Q: What is the molecular weight of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: Molecular weight of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is 256.25. |
| Q: What is the CAS number of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone? |
| A: CAS number of 3-(4-methoxyphenoxy)-1(3H)-Isobenzofuranone is 87116-18-5. |