methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate structure
|
Common Name | methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 871583-20-9 | Molecular Weight | 245.06200 | |
| Density | 1.562g/cm3 | Boiling Point | 432.22ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.199ºC | |
| Name | methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.562g/cm3 |
|---|---|
| Boiling Point | 432.22ºC at 760 mmHg |
| Molecular Formula | C9H6Cl2N2O2 |
| Molecular Weight | 245.06200 |
| Flash Point | 215.199ºC |
| Exact Mass | 243.98100 |
| PSA | 54.98000 |
| LogP | 2.65630 |
| Index of Refraction | 1.664 |
| InChIKey | UTSLJBDIAXLXSH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2c(Cl)nc(Cl)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 4,6-dichloro-5-azaindole-2-carboxylate |