methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate
Modify Date: 2026-07-18 17:32:20
![methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate Structure](https://image.chemsrc.com/caspic/432/871586-90-2.png)
methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate structure
|
Common Name | methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 871586-90-2 | Molecular Weight | 277.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16ClNO2 |
|---|---|
| Molecular Weight | 277.74600 |
| Exact Mass | 277.08700 |
| PSA | 42.09000 |
| LogP | 3.80430 |
| InChIKey | PLSRFSLUCRJQMJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCCc2c1[nH]c1ccc(Cl)cc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2-Chloro-5,6,7,8,9,10-hexahydro-cyclohepta[b]indole-6-carboxylic acid amide structure](https://image.chemsrc.com/caspic/472/371219-74-8.png)
CAS#:371219-74-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 871586-90-2? |
| A: Chinese name of 871586-90-2 is 871586-90-2. |
| Q: What is the polar surface area (PSA) of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: Polar surface area (PSA) of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is 42.09000. |
| Q: What is the CAS number of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: CAS number of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is 871586-90-2. |
| Q: What are the downstream products of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: Related downstream products(CAS) of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate: 371219-74-8. |
| Q: What is the English name of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: The English name of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate. |
| Q: What is the molecular weight of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: Molecular weight of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is 277.74600. |
| Q: What is the molecular formula of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: Molecular formula of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is C15H16ClNO2. |
| Q: What is the SMILES notation of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: SMILES notation of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is COC(=O)C1CCCCc2c1[nH]c1ccc(Cl)cc21. |
| Q: What is the LogP of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: LogP of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is 3.80430. |
| Q: What is the InChIKey of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate? |
| A: InChIKey of methyl 2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxylate is PLSRFSLUCRJQMJ-UHFFFAOYSA-N. |