(2,4,6-tritert-butylphenyl)phosphanylidenemethanone
(2,4,6-tritert-butylphenyl)phosphanylidenemethanone structure
|
Common Name | (2,4,6-tritert-butylphenyl)phosphanylidenemethanone | ||
|---|---|---|---|---|
| CAS Number | 87174-75-2 | Molecular Weight | 304.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (2,4,6-tritert-butylphenyl)phosphanylidenemethanone, Chinese name: (2,4,6-三叔丁基苯基)膦甲酮, CAS number: 87174-75-2, molecular formula: C19H29OP, molecular weight: 304.40700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4,6-tritert-butylphenyl)phosphanylidenemethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H29OP |
|---|---|
| Molecular Weight | 304.40700 |
| Exact Mass | 304.19600 |
| PSA | 51.21000 |
| LogP | 5.21780 |
| InChIKey | ZKEIKCWNNVFIRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=C=O)c(C(C)(C)C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2,4,6-tritert-... CAS#:87174-75-2 |
| Literature: Appel, Rolf; Paulen, Wilfried Angewandte Chemie, 1983 , vol. 95, # 10 p. 807 - 808 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:13517-35-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6-tri-tert-butylphenylphosphaketene |
| Phosphine,carbonyl[2,4,6-tris(1,1-dimethylethyl)phenyl] |
| 2,4,6-(t-Bu)3C6H2-P=C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: LogP of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is 5.21780. |
| Q: What is the molecular formula of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: Molecular formula of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is C19H29OP. |
| Q: What is the InChIKey of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: InChIKey of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is ZKEIKCWNNVFIRH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: Molecular weight of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is 304.40700. |
| Q: What are the downstream products of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: Related downstream products(CAS) of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone: 13517-35-6. |
| Q: What are the upstream materials of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: Related upstream materials(CAS) of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone: 75-44-5;87174-74-1. |
| Q: What is the English name of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: The English name of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is (2,4,6-tritert-butylphenyl)phosphanylidenemethanone. |
| Q: What English synonyms does (2,4,6-tritert-butylphenyl)phosphanylidenemethanone have? |
| A: English synonyms of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone: 2,4,6-tri-tert-butylphenylphosphaketene, Phosphine,carbonyl[2,4,6-tris(1,1-dimethylethyl)phenyl], 2,4,6-(t-Bu)3C6H2-P=C=O. |
| Q: What is the CAS number of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone? |
| A: CAS number of (2,4,6-tritert-butylphenyl)phosphanylidenemethanone is 87174-75-2. |
| Q: What is the Chinese name of 87174-75-2? |
| A: Chinese name of 87174-75-2 is 87174-75-2. |