4-oxo-4-[2-(3-oxo-4H-quinoxalin-2-yl)anilino]butanoic acid
Modify Date: 2026-04-13 11:27:28
![4-oxo-4-[2-(3-oxo-4H-quinoxalin-2-yl)anilino]butanoic acid Structure](https://www.chemsrc.com/extcaspic/437/871908-24-6.png)
4-oxo-4-[2-(3-oxo-4H-quinoxalin-2-yl)anilino]butanoic acid structure
|
Common Name | 4-oxo-4-[2-(3-oxo-4H-quinoxalin-2-yl)anilino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 871908-24-6 | Molecular Weight | 337.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-oxo-4-[2-(3-oxo-4H-quinoxalin-2-yl)anilino]butanoic acid |
|---|
| Molecular Formula | C18H15N3O4 |
|---|---|
| Molecular Weight | 337.3 |
| InChIKey | XNHHKOOINGXRDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3NC2=O)NC(=O)CCC(=O)O |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 1, Current Page 1 of 1
1