[2-benzoyloxy-4-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]phenyl] benzoate,hydrochloride structure
|
Common Name | [2-benzoyloxy-4-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]phenyl] benzoate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 87213-07-8 | Molecular Weight | 516.02700 | |
| Density | N/A | Boiling Point | 621.9ºC at 760mmHg | |
| Molecular Formula | C31H30ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
| Name | [2-benzoyloxy-4-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]phenyl] benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 621.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C31H30ClNO4 |
| Molecular Weight | 516.02700 |
| Flash Point | 329.9ºC |
| Exact Mass | 515.18600 |
| PSA | 55.84000 |
| LogP | 7.08080 |
| InChIKey | BQCZMOBDTBTGIW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(Cc2ccc(OC(=O)c3ccccc3)c(OC(=O)c3ccccc3)c2)N(C)C)cc1.Cl |
|
~%
[2-benzoyloxy-4... CAS#:87213-07-8 |
| Literature: Valenta; Holubek; Svatek; et al. Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 5 p. 1447 - 1464 |
|
~%
[2-benzoyloxy-4... CAS#:87213-07-8 |
| Literature: Valenta; Holubek; Svatek; et al. Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 5 p. 1447 - 1464 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| [2-benzoyloxy-4-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]phenyl] benzoate hydrochloride |
| N,N-Dimethyl-2-(3,4-dibenzoyloxyphenyl)-1-(4-tolyl)ethylamine hydrochloride |
| 1,2-Benzenediol,4-(2-(dimethylamino)-2-(4-methylphenyl)ethyl)-,dibenzoate (ester),hydrochloride |