3-methoxy-5-prop-2-enyl-4-prop-2-ynoxybenzaldehyde structure
|
Common Name | 3-methoxy-5-prop-2-enyl-4-prop-2-ynoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 872183-39-6 | Molecular Weight | 230.25900 | |
| Density | 1.094g/cm3 | Boiling Point | 360.8ºC at 760 mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.3ºC | |
| Name | 3-methoxy-5-prop-2-enyl-4-prop-2-ynoxybenzaldehyde |
|---|
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760 mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 163.3ºC |
| Exact Mass | 230.09400 |
| PSA | 35.53000 |
| LogP | 2.24820 |
| Index of Refraction | 1.553 |
| InChIKey | CXEUEEOWEPCZRS-UHFFFAOYSA-N |
| SMILES | C#CCOc1c(CC=C)cc(C=O)cc1OC |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |