3-(3,4-DIHYDROISOQUINOLIN-2(1H)-YL)PROPAN-1-OL structure
|
Common Name | 3-(3,4-DIHYDROISOQUINOLIN-2(1H)-YL)PROPAN-1-OL | ||
|---|---|---|---|---|
| CAS Number | 872196-57-1 | Molecular Weight | 263.28900 | |
| Density | 1.255g/cm3 | Boiling Point | 504.1ºC at 760 mmHg | |
| Molecular Formula | C14H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.7ºC | |
| Name | 3-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid |
|---|
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760 mmHg |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.28900 |
| Flash Point | 258.7ºC |
| Exact Mass | 263.11600 |
| PSA | 66.84000 |
| LogP | 1.71400 |
| Index of Refraction | 1.572 |
| InChIKey | LUDSGMHLAWWTNX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(OCC(=O)N2CCCCC2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |