(Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide
Modify Date: 2026-07-11 23:37:42
(Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide structure
|
Common Name | (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 872212-98-1 | Molecular Weight | 338.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19ClN2O4 |
|---|---|
| Molecular Weight | 338.78 |
| InChIKey | JBSQNORQBNEPEW-XGICHPGQSA-N |
| SMILES | COCC(C)NC(=O)C(C#N)=Cc1cc(Cl)c(OC)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: InChIKey of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is JBSQNORQBNEPEW-XGICHPGQSA-N. |
| Q: What is the Chinese name of 872212-98-1? |
| A: Chinese name of 872212-98-1 is 872212-98-1. |
| Q: What is the molecular weight of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: Molecular weight of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is 338.78. |
| Q: What is the English name of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: The English name of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide. |
| Q: What is the CAS number of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: CAS number of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is 872212-98-1. |
| Q: What is the molecular formula of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: Molecular formula of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is C16H19ClN2O4. |
| Q: What is the SMILES notation of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide? |
| A: SMILES notation of (Z)-3-(3-Chloro-4,5-dimethoxyphenyl)-2-cyano-N-(1-methoxypropan-2-yl)prop-2-enamide is COCC(C)NC(=O)C(C#N)=Cc1cc(Cl)c(OC)c(OC)c1. |