5-Hydroxycarbendazim sulfate
Modify Date: 2026-07-03 16:59:57
5-Hydroxycarbendazim sulfate structure
|
Common Name | 5-Hydroxycarbendazim sulfate | ||
|---|---|---|---|---|
| CAS Number | 87237-40-9 | Molecular Weight | 297.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Hydroxycarbendazim sulfate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19N3O3S |
|---|---|
| Molecular Weight | 297.38 |
| InChIKey | FRNXUACVXIFZHN-UHFFFAOYSA-N |
| SMILES | C=S(=C)(C)C.COC(=O)Nc1nc2ccc(O)cc2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 87237-40-9? |
| A: Chinese name of 87237-40-9 is 87237-40-9. |
| Q: What is the InChIKey of 5-Hydroxycarbendazim sulfate? |
| A: InChIKey of 5-Hydroxycarbendazim sulfate is FRNXUACVXIFZHN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Hydroxycarbendazim sulfate? |
| A: Molecular weight of 5-Hydroxycarbendazim sulfate is 297.38. |
| Q: What is the English name of 5-Hydroxycarbendazim sulfate? |
| A: The English name of 5-Hydroxycarbendazim sulfate is 5-Hydroxycarbendazim sulfate. |
| Q: What is the SMILES notation of 5-Hydroxycarbendazim sulfate? |
| A: SMILES notation of 5-Hydroxycarbendazim sulfate is C=S(=C)(C)C.COC(=O)Nc1nc2ccc(O)cc2[nH]1. |
| Q: What is the CAS number of 5-Hydroxycarbendazim sulfate? |
| A: CAS number of 5-Hydroxycarbendazim sulfate is 87237-40-9. |
| Q: What is the molecular formula of 5-Hydroxycarbendazim sulfate? |
| A: Molecular formula of 5-Hydroxycarbendazim sulfate is C13H19N3O3S. |