D-Asparagine tert-Butyl Ester Hydrochloride
Modify Date: 2025-08-29 18:47:38
D-Asparagine tert-Butyl Ester Hydrochloride structure
|
Common Name | D-Asparagine tert-Butyl Ester Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 87244-02-8 | Molecular Weight | 224.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | D-Asparagine tert-Butyl Ester Hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H17ClN2O3 |
|---|---|
| Molecular Weight | 224.68 |
| InChIKey | RXNKCUXXNGWROA-NUBCRITNSA-N |
| SMILES | CC(C)(C)OC(=O)C(N)CC(N)=O.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: InChIKey of D-Asparagine tert-Butyl Ester Hydrochloride is RXNKCUXXNGWROA-NUBCRITNSA-N. |
| Q: What is the CAS number of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: CAS number of D-Asparagine tert-Butyl Ester Hydrochloride is 87244-02-8. |
| Q: What is the English name of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: The English name of D-Asparagine tert-Butyl Ester Hydrochloride is D-Asparagine tert-Butyl Ester Hydrochloride. |
| Q: What is the SMILES notation of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: SMILES notation of D-Asparagine tert-Butyl Ester Hydrochloride is CC(C)(C)OC(=O)C(N)CC(N)=O.Cl. |
| Q: What is the molecular weight of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: Molecular weight of D-Asparagine tert-Butyl Ester Hydrochloride is 224.68. |
| Q: What is the Chinese name of 87244-02-8? |
| A: Chinese name of 87244-02-8 is 87244-02-8. |
| Q: What is the molecular formula of D-Asparagine tert-Butyl Ester Hydrochloride? |
| A: Molecular formula of D-Asparagine tert-Butyl Ester Hydrochloride is C8H17ClN2O3. |