hexyl 2-amino-4-phenyl-butanoate hydrochloride
Modify Date: 2025-11-04 23:00:22
hexyl 2-amino-4-phenyl-butanoate hydrochloride structure
|
Common Name | hexyl 2-amino-4-phenyl-butanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 87253-05-2 | Molecular Weight | 299.83600 | |
| Density | N/A | Boiling Point | 372.5ºC at 760 mmHg | |
| Molecular Formula | C16H26ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | hexyl 2-amino-4-phenylbutanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 372.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.83600 |
| Flash Point | 212.6ºC |
| Exact Mass | 299.16500 |
| PSA | 52.32000 |
| LogP | 4.57230 |
| InChIKey | KZLVLNVMEIKOCQ-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C(N)CCc1ccccc1.Cl |
| HS Code | 2922499990 |
|---|
|
~90%
hexyl 2-amino-4... CAS#:87253-05-2 |
| Literature: Schulz; Sprung; Kroning Pharmazie, 1983 , vol. 38, # 5 p. 310 - 313 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| DL-2-Amino-4-phenylbutyric acid hexyl ester hydrochloride |
| hexyl 2-amino-4-phenylbutanoate hydrochloride |
| Butyric acid,2-amino-4-phenyl-,hexyl ester,hydrochloride,DL |