2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride
2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride structure
|
Common Name | 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 87254-52-2 | Molecular Weight | 246.71100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClO3S |
|---|---|
| Molecular Weight | 246.71100 |
| Exact Mass | 246.01200 |
| PSA | 51.75000 |
| LogP | 3.40840 |
| InChIKey | RVJAQMKTLLXHTD-UHFFFAOYSA-N |
| SMILES | CC1(C)Cc2cccc(S(=O)(=O)Cl)c2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2-dimethyl-3H... CAS#:87254-52-2 |
| Literature: FMC Corporation Patent: US4743291 A1, 1988 ; |
|
~%
2,2-dimethyl-3H... CAS#:87254-52-2 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4514211 A1, 1985 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3-dihydro-2,2-dimethyl-7-benzofuransulfonyl chloride |
| 7-Benzofuransulfonyl chloride,2,3-dihydro-2,2-dimethyl |
| 7-chlorosulfonyl-2,3-dihydro-2,2-dimethylbenzofuran |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: CAS number of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is 87254-52-2. |
| Q: What is the InChIKey of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: InChIKey of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is RVJAQMKTLLXHTD-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: Related upstream materials(CAS) of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride: 7447-39-4;68298-46-4;109-69-3. |
| Q: What English synonyms does 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride have? |
| A: English synonyms of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride: 2,3-dihydro-2,2-dimethyl-7-benzofuransulfonyl chloride, 7-Benzofuransulfonyl chloride,2,3-dihydro-2,2-dimethyl, 7-chlorosulfonyl-2,3-dihydro-2,2-dimethylbenzofuran. |
| Q: What is the SMILES notation of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: SMILES notation of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is CC1(C)Cc2cccc(S(=O)(=O)Cl)c2O1. |
| Q: What is the LogP of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: LogP of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is 3.40840. |
| Q: What is the Chinese name of 87254-52-2? |
| A: Chinese name of 87254-52-2 is 87254-52-2. |
| Q: What is the English name of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: The English name of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride. |
| Q: What is the molecular weight of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: Molecular weight of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is 246.71100. |
| Q: What is the molecular formula of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride? |
| A: Molecular formula of 2,2-dimethyl-3H-1-benzofuran-7-sulfonyl chloride is C10H11ClO3S. |