2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione
Modify Date: 2026-10-07 15:47:10
![2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione Structure](https://www.chemsrc.com/extcaspic/254/872838-93-2.png)
2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione structure
|
Common Name | 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 872838-93-2 | Molecular Weight | 357.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H23N5O3 |
|---|---|
| Molecular Weight | 357.4 |
| InChIKey | POPLXDMSFNZJSF-UHFFFAOYSA-N |
| SMILES | CCOCCN1C(=O)C2C(N=C3N(c4ccccc4)CCN32)N(C)C1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: Molecular formula of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is C18H23N5O3. |
| Q: What is the CAS number of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: CAS number of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is 872838-93-2. |
| Q: What is the Chinese name of 872838-93-2? |
| A: Chinese name of 872838-93-2 is 872838-93-2. |
| Q: What is the InChIKey of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: InChIKey of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is POPLXDMSFNZJSF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: The English name of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione. |
| Q: What is the molecular weight of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: Molecular weight of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is 357.4. |
| Q: What is the SMILES notation of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione? |
| A: SMILES notation of 2-(2-Ethoxyethyl)-4-methyl-6-phenyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione is CCOCCN1C(=O)C2C(N=C3N(c4ccccc4)CCN32)N(C)C1=O. |