N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-oxopropanamide structure
|
Common Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-oxopropanamide | ||
|---|---|---|---|---|
| CAS Number | 87310-69-8 | Molecular Weight | 256.18100 | |
| Density | 1.401g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-oxopropanamide |
|---|
| Density | 1.401g/cm3 |
|---|---|
| Molecular Formula | C11H7F3N2O2 |
| Molecular Weight | 256.18100 |
| Exact Mass | 256.04600 |
| PSA | 69.96000 |
| LogP | 2.17758 |
| Index of Refraction | 1.503 |
| InChIKey | KSMBAOCZDHBYCQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
|
~82%
N-[4-Cyano-3-(t... CAS#:87310-69-8 |
| Literature: James, Kenneth D.; Ekwuribe, Nnochiri N. Synthesis, 2002 , # 7 p. 850 - 852 |
|
~%
N-[4-Cyano-3-(t... CAS#:87310-69-8 |
| Literature: Parent, Ephraim E.; Dence, Carmen S.; Jenks, Carl; Sharp, Terry L.; Welch, Michael J.; Katzenellenbogen, John A. Journal of Medicinal Chemistry, 2007 , vol. 50, # 5 p. 1028 - 1040 |